C10H19FO2 — CID 15881149
(2R,3S)-3-fluoro-3,7-dimethyloct-6-ene-1,2-diol (PubChem CID 15881149) has the molecular formula C10H19FO2 and a molecular weight of 190.26 g/mol. Its IUPAC name is (2R,3S)-3-fluoro-3,7-dimethyloct-6-ene-1,2-diol.
| Compound Name | (2R,3S)-3-fluoro-3,7-dimethyloct-6-ene-1,2-diol |
|---|---|
| PubChem CID | 15881149 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (2R,3S)-3-fluoro-3,7-dimethyloct-6-ene-1,2-diol |
| SMILES | CC(C)=CCC[C@](C)(F)[C@H](O)CO |
| InChI | InChI=1S/C10H19FO2/c1-8(2)5-4-6-10(3,11)9(13)7-12/h5,9,12-13H,4,6-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | GMYZJGWYQDTRGG-ZJUUUORDSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|