C19H40O3Si — CID 11142486
(Z,2R,3S,4S,5R)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-ene-2,4-diol (PubChem CID 11142486) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is (Z,2R,3S,4S,5R)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-ene-2,4-diol.
| Compound Name | (Z,2R,3S,4S,5R)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-ene-2,4-diol |
|---|---|
| PubChem CID | 11142486 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (Z,2R,3S,4S,5R)-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-ene-2,4-diol |
| SMILES | C/C=C\[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H40O3Si/c1-10-11-16(8)19(21)17(9)18(20)12-22-23(13(2)3,14(4)5)15(6)7/h10-11,13-21H,12H2,1-9H3/b11-10-/t16-,17-,18+,19+/m1/s1 |
| InChIKey | ORLBFSONHCRDGV-ODQLWDJGSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|