C15H32O3Si — CID 11196999
(E,2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-6-ene-3,5-diol (PubChem CID 11196999) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is (E,2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-6-ene-3,5-diol.
| Compound Name | (E,2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-6-ene-3,5-diol |
|---|---|
| PubChem CID | 11196999 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (E,2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-6-ene-3,5-diol |
| SMILES | C/C=C/[C@H](O)[C@@H](C)[C@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-9-10-13(16)11(2)14(17)12(3)18-19(7,8)15(4,5)6/h9-14,16-17H,1-8H3/b10-9+/t11-,12+,13+,14+/m1/s1 |
| InChIKey | SGJHNDFADJMWTP-CGGYXVSXSA-N |
| XLogP | 3.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|