C16H34O3Si — CID 10685808
(E)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-6-ene-2,3-diol (PubChem CID 10685808) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (E)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-6-ene-2,3-diol.
| Compound Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-6-ene-2,3-diol |
|---|---|
| PubChem CID | 10685808 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyloct-6-ene-2,3-diol |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C16H34O3Si/c1-13(9-10-14(17)16(5,6)18)11-12-19-20(7,8)15(2,3)4/h11,14,17-18H,9-10,12H2,1-8H3/b13-11+ |
| InChIKey | LCXKKYRPWWLVQM-ACCUITESSA-N |
| XLogP | 3.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|