C16H32O3Si — CID 11301047
(1S,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-ylcyclohept-3-ene-1,2-diol (PubChem CID 11301047) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (1S,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-ylcyclohept-3-ene-1,2-diol.
| Compound Name | (1S,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-ylcyclohept-3-ene-1,2-diol |
|---|---|
| PubChem CID | 11301047 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1S,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-propan-2-ylcyclohept-3-ene-1,2-diol |
| SMILES | CC(C)C1=CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O3Si/c1-11(2)13-9-8-12(10-14(17)15(13)18)19-20(6,7)16(3,4)5/h9,11-12,14-15,17-18H,8,10H2,1-7H3/t12-,14+,15-/m1/s1 |
| InChIKey | LSSYTFOQURYSNT-VHDGCEQUSA-N |
| XLogP | 3.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|