C23H50O3Si2 — CID 134883122
(E,4S,5S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylnon-2-en-1-ol (PubChem CID 134883122) has the molecular formula C23H50O3Si2 and a molecular weight of 430.82 g/mol. Its IUPAC name is (E,4S,5S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylnon-2-en-1-ol.
| Compound Name | (E,4S,5S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylnon-2-en-1-ol |
|---|---|
| PubChem CID | 134883122 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (E,4S,5S)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylnon-2-en-1-ol |
| SMILES | C/C(=C\[C@H](C)[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C23H50O3Si2/c1-19(18-24)17-20(2)21(26-28(11,12)23(6,7)8)15-13-14-16-25-27(9,10)22(3,4)5/h17,20-21,24H,13-16,18H2,1-12H3/b19-17+/t20-,21-/m0/s1 |
| InChIKey | XDASEUXRBTYASL-VIUSAGFSSA-N |
| XLogP | 7.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|