C18H36O2Si — CID 24795825
5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohepten-1-yl)pentan-1-ol (PubChem CID 24795825) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohepten-1-yl)pentan-1-ol.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohepten-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 24795825 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-1-(cyclohepten-1-yl)pentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(O)C1=CCCCCC1 |
| InChI | InChI=1S/C18H36O2Si/c1-18(2,3)21(4,5)20-15-11-10-14-17(19)16-12-8-6-7-9-13-16/h12,17,19H,6-11,13-15H2,1-5H3 |
| InChIKey | VSLDEUWRJYSOJQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|