C20H42O3Si2 — CID 15543738
(1S,2Z,4S,7R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]cyclooct-2-en-1-ol (PubChem CID 15543738) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is (1S,2Z,4S,7R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]cyclooct-2-en-1-ol.
| Compound Name | (1S,2Z,4S,7R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]cyclooct-2-en-1-ol |
|---|---|
| PubChem CID | 15543738 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (1S,2Z,4S,7R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]cyclooct-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)/C=C\[C@@H](O)C1 |
| InChI | InChI=1S/C20H42O3Si2/c1-19(2,3)24(7,8)22-17-12-11-16(21)15-18(14-13-17)23-25(9,10)20(4,5)6/h11-12,16-18,21H,13-15H2,1-10H3/b12-11-/t16-,17-,18-/m1/s1 |
| InChIKey | HGTXLVFMCDMVLP-GCNJGVOGSA-N |
| XLogP | 5.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|