C31H66O3Si2 — CID 56594145
(3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-ol (PubChem CID 56594145) has the molecular formula C31H66O3Si2 and a molecular weight of 543.04 g/mol. Its IUPAC name is (3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-ol.
| Compound Name | (3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-ol |
|---|---|
| PubChem CID | 56594145 |
| Molecular Formula | C31H66O3Si2 |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.46 |
| IUPAC Name | (3R,4S,6R)-3,4-bis[tri(propan-2-yl)silyloxy]tridec-1-en-6-ol |
| SMILES | C=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C[C@H](O)CCCCCCC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H66O3Si2/c1-15-17-18-19-20-21-29(32)22-31(34-36(26(9)10,27(11)12)28(13)14)30(16-2)33-35(23(3)4,24(5)6)25(7)8/h16,23-32H,2,15,17-22H2,1,3-14H3/t29-,30-,31+/m1/s1 |
| InChIKey | NYHARMAZHJIIIX-OLUZHXLYSA-N |
| XLogP | 10.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|