C21H44O2Si — CID 134831056
(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-ol (PubChem CID 134831056) has the molecular formula C21H44O2Si and a molecular weight of 356.67 g/mol. Its IUPAC name is (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-ol.
| Compound Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-ol |
|---|---|
| PubChem CID | 134831056 |
| Molecular Formula | C21H44O2Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-ol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CCCCCCCCCC |
| InChI | InChI=1S/C21H44O2Si/c1-8-10-11-12-13-14-15-16-18-19(22)20(17-9-2)23-24(6,7)21(3,4)5/h9,19-20,22H,2,8,10-18H2,1,3-7H3/t19-,20+/m1/s1 |
| InChIKey | NSUJSKYVAHANQB-UXHICEINSA-N |
| XLogP | 6.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|