C17H36O2Si — CID 24767663
(3S,4S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnon-1-en-4-ol (PubChem CID 24767663) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is (3S,4S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnon-1-en-4-ol.
| Compound Name | (3S,4S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnon-1-en-4-ol |
|---|---|
| PubChem CID | 24767663 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (3S,4S,7S)-9-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylnon-1-en-4-ol |
| SMILES | C=C[C@H](C)[C@@H](O)CC[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O2Si/c1-9-15(3)16(18)11-10-14(2)12-13-19-20(7,8)17(4,5)6/h9,14-16,18H,1,10-13H2,2-8H3/t14-,15-,16-/m0/s1 |
| InChIKey | QEXPPJZHMZXBRO-JYJNAYRXSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|