C16H30O2 — CID 10015198
(3S,4S,7R,8R)-4,7-bis(ethenyl)-2,9-dimethyldecane-3,8-diol (PubChem CID 10015198) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3S,4S,7R,8R)-4,7-bis(ethenyl)-2,9-dimethyldecane-3,8-diol.
| Compound Name | (3S,4S,7R,8R)-4,7-bis(ethenyl)-2,9-dimethyldecane-3,8-diol |
|---|---|
| PubChem CID | 10015198 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3S,4S,7R,8R)-4,7-bis(ethenyl)-2,9-dimethyldecane-3,8-diol |
| SMILES | C=C[C@H](CC[C@H](C=C)[C@H](O)C(C)C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C16H30O2/c1-7-13(15(17)11(3)4)9-10-14(8-2)16(18)12(5)6/h7-8,11-18H,1-2,9-10H2,3-6H3/t13-,14+,15+,16- |
| InChIKey | CKHCFFDZMFRHJE-SYMSYNOKSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|