C24H49FO3Si2 — CID 169294434
(3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2-methyl-6-tri(propan-2-yl)silyloxyocta-1,7-dien-4-ol (PubChem CID 169294434) has the molecular formula C24H49FO3Si2 and a molecular weight of 460.82 g/mol. Its IUPAC name is (3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2-methyl-6-tri(propan-2-yl)silyloxyocta-1,7-dien-4-ol.
| Compound Name | (3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2-methyl-6-tri(propan-2-yl)silyloxyocta-1,7-dien-4-ol |
|---|---|
| PubChem CID | 169294434 |
| Molecular Formula | C24H49FO3Si2 |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | (3R,4R,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2-methyl-6-tri(propan-2-yl)silyloxyocta-1,7-dien-4-ol |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](F)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(=C)C |
| InChI | InChI=1S/C24H49FO3Si2/c1-15-20(27-30(17(4)5,18(6)7)19(8)9)21(25)22(26)23(16(2)3)28-29(13,14)24(10,11)12/h15,17-23,26H,1-2H2,3-14H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | CXSSKHHCZASICV-GSPCLOLRSA-N |
| XLogP | 7.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|