C13H29O3Si+ — CID 135036750
[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-enyl]oxidanium (PubChem CID 135036750) has the molecular formula C13H29O3Si+ and a molecular weight of 261.46 g/mol. Its IUPAC name is [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-enyl]oxidanium.
| Compound Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-enyl]oxidanium |
|---|---|
| PubChem CID | 135036750 |
| Molecular Formula | C13H29O3Si+ |
| Molecular Weight | 261.46 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhept-6-enyl]oxidanium |
| SMILES | C=CC[C@@H](C[C@H](O)C[OH2+])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O3Si/c1-7-8-12(9-11(15)10-14)16-17(5,6)13(2,3)4/h7,11-12,14-15H,1,8-10H2,2-6H3/p+1/t11-,12-/m0/s1 |
| InChIKey | GKSXXMLTANIJJG-RYUDHWBXSA-O |
| XLogP | 2.43 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|