C15H32O2Si — CID 13382778
(E)-3-trimethylsilyldodec-2-ene-1,4-diol (PubChem CID 13382778) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (E)-3-trimethylsilyldodec-2-ene-1,4-diol.
| Compound Name | (E)-3-trimethylsilyldodec-2-ene-1,4-diol |
|---|---|
| PubChem CID | 13382778 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (E)-3-trimethylsilyldodec-2-ene-1,4-diol |
| SMILES | CCCCCCCCC(O)/C(=C\CO)[Si](C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-5-6-7-8-9-10-11-14(17)15(12-13-16)18(2,3)4/h12,14,16-17H,5-11,13H2,1-4H3/b15-12+ |
| InChIKey | RAKFKXOWLCXRHT-NTCAYCPXSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|