C25H48OSi — CID 10739293
(1E)-1-[(2E)-2-hexylidenecyclohexylidene]-1-trimethylsilyldecan-2-ol (PubChem CID 10739293) has the molecular formula C25H48OSi and a molecular weight of 392.74 g/mol. Its IUPAC name is (1E)-1-[(2E)-2-hexylidenecyclohexylidene]-1-trimethylsilyldecan-2-ol.
| Compound Name | (1E)-1-[(2E)-2-hexylidenecyclohexylidene]-1-trimethylsilyldecan-2-ol |
|---|---|
| PubChem CID | 10739293 |
| Molecular Formula | C25H48OSi |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.35 |
| IUPAC Name | (1E)-1-[(2E)-2-hexylidenecyclohexylidene]-1-trimethylsilyldecan-2-ol |
| SMILES | CCCCC/C=C1\CCCC\C1=C(\C(O)CCCCCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C25H48OSi/c1-6-8-10-12-13-15-21-24(26)25(27(3,4)5)23-20-17-16-19-22(23)18-14-11-9-7-2/h18,24,26H,6-17,19-21H2,1-5H3/b22-18+,25-23+ |
| InChIKey | CZDPANOHHLRFPM-CNDXUAGCSA-N |
| XLogP | 8.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|