C22H41IOSi — CID 11167454
(4Z,6Z)-4-hexyl-6-[iodo(trimethylsilyl)methylidene]dodeca-1,4-dien-3-ol (PubChem CID 11167454) has the molecular formula C22H41IOSi and a molecular weight of 476.56 g/mol. Its IUPAC name is (4Z,6Z)-4-hexyl-6-[iodo(trimethylsilyl)methylidene]dodeca-1,4-dien-3-ol.
| Compound Name | (4Z,6Z)-4-hexyl-6-[iodo(trimethylsilyl)methylidene]dodeca-1,4-dien-3-ol |
|---|---|
| PubChem CID | 11167454 |
| Molecular Formula | C22H41IOSi |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (4Z,6Z)-4-hexyl-6-[iodo(trimethylsilyl)methylidene]dodeca-1,4-dien-3-ol |
| SMILES | C=CC(O)/C(=C\C(CCCCCC)=C(/I)[Si](C)(C)C)CCCCCC |
| InChI | InChI=1S/C22H41IOSi/c1-7-10-12-14-16-19(21(24)9-3)18-20(17-15-13-11-8-2)22(23)25(4,5)6/h9,18,21,24H,3,7-8,10-17H2,1-2,4-6H3/b19-18-,22-20+ |
| InChIKey | NNWNIEFFOJKKFL-PCRAQWQMSA-N |
| XLogP | 7.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|