C18H37IO2Si — CID 135015260
(Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodododec-2-en-1-ol (PubChem CID 135015260) has the molecular formula C18H37IO2Si and a molecular weight of 440.48 g/mol. Its IUPAC name is (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodododec-2-en-1-ol.
| Compound Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodododec-2-en-1-ol |
|---|---|
| PubChem CID | 135015260 |
| Molecular Formula | C18H37IO2Si |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodododec-2-en-1-ol |
| SMILES | CCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)/C(I)=C/CO |
| InChI | InChI=1S/C18H37IO2Si/c1-7-8-9-10-11-12-13-17(16(19)14-15-20)21-22(5,6)18(2,3)4/h14,17,20H,7-13,15H2,1-6H3/b16-14-/t17-/m1/s1 |
| InChIKey | VPPIWBRBGAPOIR-YHKKIHSWSA-N |
| XLogP | 6.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|