C27H58O2SiSn — CID 135007562
(E)-4-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylnon-2-en-1-ol (PubChem CID 135007562) has the molecular formula C27H58O2SiSn and a molecular weight of 561.56 g/mol. Its IUPAC name is (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylnon-2-en-1-ol.
| Compound Name | (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylnon-2-en-1-ol |
|---|---|
| PubChem CID | 135007562 |
| Molecular Formula | C27H58O2SiSn |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | (E)-4-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylnon-2-en-1-ol |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)/C(=C\CO)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H31O2Si.3C4H9.Sn/c1-7-8-9-11-14(12-10-13-16)17-18(5,6)15(2,3)4;3*1-3-4-2;/h10,14,16H,7-9,11,13H2,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | JHFMXXPRWDKEFW-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|