C20H38O3Si — CID 134873855
(10Z)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxytetradeca-1,10-dien-1-one (PubChem CID 134873855) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (10Z)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxytetradeca-1,10-dien-1-one.
| Compound Name | (10Z)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxytetradeca-1,10-dien-1-one |
|---|---|
| PubChem CID | 134873855 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (10Z)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxytetradeca-1,10-dien-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(C=C=O)CCCCCC/C=C\CCCO |
| InChI | InChI=1S/C20H38O3Si/c1-20(2,3)24(4,5)23-19(16-18-22)15-13-11-9-7-6-8-10-12-14-17-21/h8,10,16,19,21H,6-7,9,11-15,17H2,1-5H3/b10-8- |
| InChIKey | LQNNUTIJPKHJLJ-NTMALXAHSA-N |
| XLogP | 5.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|