C23H48O2Si2 — CID 134878942
(1Z,10Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)trideca-1,10-dien-4-ol (PubChem CID 134878942) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is (1Z,10Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)trideca-1,10-dien-4-ol.
| Compound Name | (1Z,10Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)trideca-1,10-dien-4-ol |
|---|---|
| PubChem CID | 134878942 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | (1Z,10Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)trideca-1,10-dien-4-ol |
| SMILES | CC/C=C\CCCCCC(O)C/C(=C/O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-10-11-12-13-14-15-16-17-22(24)18-21(20-26(5,6)7)19-25-27(8,9)23(2,3)4/h11-12,19,22,24H,10,13-18,20H2,1-9H3/b12-11-,21-19- |
| InChIKey | VSIRCLRIVOKTRZ-IKLYFRALSA-N |
| XLogP | 7.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|