C22H40OSi — CID 11068043
7-cyclohexa-1,4-dien-1-ylhept-1-en-4-yloxy-tri(propan-2-yl)silane (PubChem CID 11068043) has the molecular formula C22H40OSi and a molecular weight of 348.65 g/mol. Its IUPAC name is 7-cyclohexa-1,4-dien-1-ylhept-1-en-4-yloxy-tri(propan-2-yl)silane.
| Compound Name | 7-cyclohexa-1,4-dien-1-ylhept-1-en-4-yloxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11068043 |
| Molecular Formula | C22H40OSi |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 7-cyclohexa-1,4-dien-1-ylhept-1-en-4-yloxy-tri(propan-2-yl)silane |
| SMILES | C=CCC(CCCC1=CCC=CC1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40OSi/c1-8-13-22(17-12-16-21-14-10-9-11-15-21)23-24(18(2)3,19(4)5)20(6)7/h8-10,15,18-20,22H,1,11-14,16-17H2,2-7H3 |
| InChIKey | JDKBJINLKCZQNX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|