C17H34OSi — CID 91697185
trimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane (PubChem CID 91697185) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is trimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane.
| Compound Name | trimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane |
|---|---|
| PubChem CID | 91697185 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | trimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane |
| SMILES | C/C=C\C/C=C/CCCCCCCCO[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2,3)4/h5-6,8-9H,7,10-17H2,1-4H3/b6-5-,9-8+ |
| InChIKey | QHOVXKAKEYDMNM-UEPDSTOUSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|