C20H40OSi — CID 91697354
tert-butyl-dimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane (PubChem CID 91697354) has the molecular formula C20H40OSi and a molecular weight of 324.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane |
|---|---|
| PubChem CID | 91697354 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl-dimethyl-[(9E,12Z)-tetradeca-9,12-dienoxy]silane |
| SMILES | C/C=C\C/C=C/CCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40OSi/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-21-22(5,6)20(2,3)4/h7-8,10-11H,9,12-19H2,1-6H3/b8-7-,11-10+ |
| InChIKey | WRQNLIKVUWZVMA-QEFCTBRHSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|