C22H42O3Si — CID 11111747
(Z)-12-[tert-butyl(dimethyl)silyl]oxy-14-ethoxytetradec-4-en-13-yn-1-ol (PubChem CID 11111747) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (Z)-12-[tert-butyl(dimethyl)silyl]oxy-14-ethoxytetradec-4-en-13-yn-1-ol.
| Compound Name | (Z)-12-[tert-butyl(dimethyl)silyl]oxy-14-ethoxytetradec-4-en-13-yn-1-ol |
|---|---|
| PubChem CID | 11111747 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (Z)-12-[tert-butyl(dimethyl)silyl]oxy-14-ethoxytetradec-4-en-13-yn-1-ol |
| SMILES | CCOC#CC(CCCCCC/C=C\CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-7-24-20-18-21(25-26(5,6)22(2,3)4)17-15-13-11-9-8-10-12-14-16-19-23/h10,12,21,23H,7-9,11,13-17,19H2,1-6H3/b12-10- |
| InChIKey | FFNCTVDSDAZSOM-BENRWUELSA-N |
| XLogP | 6.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|