C19H38O2Si2 — CID 139252747
6-[tert-butyl(dimethyl)silyl]oxy-10-trimethylsilyldec-1-en-9-yn-4-ol (PubChem CID 139252747) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-10-trimethylsilyldec-1-en-9-yn-4-ol.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-10-trimethylsilyldec-1-en-9-yn-4-ol |
|---|---|
| PubChem CID | 139252747 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-10-trimethylsilyldec-1-en-9-yn-4-ol |
| SMILES | C=CCC(O)CC(CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-10-13-17(20)16-18(14-11-12-15-22(5,6)7)21-23(8,9)19(2,3)4/h10,17-18,20H,1,11,13-14,16H2,2-9H3 |
| InChIKey | QEBPYOWFYHYFPF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|