C27H52OSi — CID 11247187
tert-butyl-[(E)-henicos-8-en-6-yn-11-yl]oxy-dimethylsilane (PubChem CID 11247187) has the molecular formula C27H52OSi and a molecular weight of 420.80 g/mol. Its IUPAC name is tert-butyl-[(E)-henicos-8-en-6-yn-11-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-henicos-8-en-6-yn-11-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11247187 |
| Molecular Formula | C27H52OSi |
| Molecular Weight | 420.80 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | tert-butyl-[(E)-henicos-8-en-6-yn-11-yl]oxy-dimethylsilane |
| SMILES | CCCCCC#C/C=C/CC(CCCCCCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52OSi/c1-8-10-12-14-16-18-20-22-24-26(28-29(6,7)27(3,4)5)25-23-21-19-17-15-13-11-9-2/h21,23,26H,8-16,18,20,22,24-25H2,1-7H3/b23-21+ |
| InChIKey | FPWCMVIUMQCJLN-XTQSDGFTSA-N |
| XLogP | 9.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.80 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|