C27H54OSi — CID 11327675
tert-butyl-[(6Z,8E)-henicosa-6,8-dien-11-yl]oxy-dimethylsilane (PubChem CID 11327675) has the molecular formula C27H54OSi and a molecular weight of 422.81 g/mol. Its IUPAC name is tert-butyl-[(6Z,8E)-henicosa-6,8-dien-11-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(6Z,8E)-henicosa-6,8-dien-11-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11327675 |
| Molecular Formula | C27H54OSi |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | tert-butyl-[(6Z,8E)-henicosa-6,8-dien-11-yl]oxy-dimethylsilane |
| SMILES | CCCCC/C=C\C=C\CC(CCCCCCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54OSi/c1-8-10-12-14-16-18-20-22-24-26(28-29(6,7)27(3,4)5)25-23-21-19-17-15-13-11-9-2/h16,18,20,22,26H,8-15,17,19,21,23-25H2,1-7H3/b18-16-,22-20+ |
| InChIKey | GIQQFHYFPMRRMI-PUXICNRBSA-N |
| XLogP | 9.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|