C21H38OSi — CID 11232927
tert-butyl-[(1S)-1-[(1R,2E)-cycloundec-2-en-1-yl]but-3-ynoxy]-dimethylsilane (PubChem CID 11232927) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(1R,2E)-cycloundec-2-en-1-yl]but-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(1R,2E)-cycloundec-2-en-1-yl]but-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11232927 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | tert-butyl-[(1S)-1-[(1R,2E)-cycloundec-2-en-1-yl]but-3-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1/C=C/CCCCCCCC1 |
| InChI | InChI=1S/C21H38OSi/c1-7-16-20(22-23(5,6)21(2,3)4)19-17-14-12-10-8-9-11-13-15-18-19/h1,14,17,19-20H,8-13,15-16,18H2,2-6H3/b17-14+/t19-,20-/m0/s1 |
| InChIKey | VIUAMYBWYIIDHF-JVWCMJTJSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|