C22H42O2Si — CID 135015376
tert-butyl-[(E,6R,7R,8R,9S)-8-methoxy-7,9-dimethyltridec-3-en-11-yn-6-yl]oxy-dimethylsilane (PubChem CID 135015376) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is tert-butyl-[(E,6R,7R,8R,9S)-8-methoxy-7,9-dimethyltridec-3-en-11-yn-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,6R,7R,8R,9S)-8-methoxy-7,9-dimethyltridec-3-en-11-yn-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135015376 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | tert-butyl-[(E,6R,7R,8R,9S)-8-methoxy-7,9-dimethyltridec-3-en-11-yn-6-yl]oxy-dimethylsilane |
| SMILES | CC#CC[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C/C=C/CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O2Si/c1-11-13-15-17-20(24-25(9,10)22(5,6)7)19(4)21(23-8)18(3)16-14-12-2/h13,15,18-21H,11,16-17H2,1-10H3/b15-13+/t18-,19-,20+,21+/m0/s1 |
| InChIKey | PNTLZVKJVMOKEP-USUHEVARSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|