C20H42OSi — CID 139263530
tert-butyl-dimethyl-[(5S,6S)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane (PubChem CID 139263530) has the molecular formula C20H42OSi and a molecular weight of 326.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S,6S)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(5S,6S)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane |
|---|---|
| PubChem CID | 139263530 |
| Molecular Formula | C20H42OSi |
| Molecular Weight | 326.64 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | tert-butyl-dimethyl-[(5S,6S)-6-(2-methylprop-1-enyl)decan-5-yl]oxysilane |
| SMILES | CCCC[C@@H](C=C(C)C)[C@H](CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42OSi/c1-10-12-14-18(16-17(3)4)19(15-13-11-2)21-22(8,9)20(5,6)7/h16,18-19H,10-15H2,1-9H3/t18-,19-/m0/s1 |
| InChIKey | PTXDAEIMVBQKKG-OALUTQOASA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|