C26H50O3Si — CID 102089060
tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[(2S)-2-methoxypent-4-enyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane (PubChem CID 102089060) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[(2S)-2-methoxypent-4-enyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[(2S)-2-methoxypent-4-enyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102089060 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | tert-butyl-[(E,2R)-1-[(2S,5S,6R)-6-[(2S)-2-methoxypent-4-enyl]-5-methyloxan-2-yl]-6-methylhept-3-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](C[C@H]1O[C@H](C[C@H](/C=C/CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C)OC |
| InChI | InChI=1S/C26H50O3Si/c1-11-13-22(27-8)19-25-21(4)16-17-23(28-25)18-24(15-12-14-20(2)3)29-30(9,10)26(5,6)7/h11-12,15,20-25H,1,13-14,16-19H2,2-10H3/b15-12+/t21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | CUTALMLFYIRLMO-IUGWGIODSA-N |
| XLogP | 7.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|