C24H44O2Si — CID 134900451
tert-butyl-[(E)-3-cyclohexyl-2-[(2S,3S,6R)-3-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 134900451) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is tert-butyl-[(E)-3-cyclohexyl-2-[(2S,3S,6R)-3-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-cyclohexyl-2-[(2S,3S,6R)-3-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134900451 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | tert-butyl-[(E)-3-cyclohexyl-2-[(2S,3S,6R)-3-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@H]1CC[C@H](C)[C@@H](/C(=C/C2CCCCC2)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H44O2Si/c1-8-12-22-16-15-19(2)23(26-22)21(17-20-13-10-9-11-14-20)18-25-27(6,7)24(3,4)5/h8,12,17,19-20,22-23H,9-11,13-16,18H2,1-7H3/b12-8+,21-17+/t19-,22-,23-/m0/s1 |
| InChIKey | RZSVVUVUSBORRS-XSRUSOFJSA-N |
| XLogP | 7.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|