C21H39NO3Si — CID 11394924
tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dien-2-yl]piperidine-1-carboxylate (PubChem CID 11394924) has the molecular formula C21H39NO3Si and a molecular weight of 381.63 g/mol. Its IUPAC name is tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dien-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dien-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11394924 |
| Molecular Formula | C21H39NO3Si |
| Molecular Weight | 381.63 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dien-2-yl]piperidine-1-carboxylate |
| SMILES | CC=C=C(CO[Si](C)(C)C(C)(C)C)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO3Si/c1-10-13-17(16-24-26(8,9)21(5,6)7)18-14-11-12-15-22(18)19(23)25-20(2,3)4/h10,18H,11-12,14-16H2,1-9H3 |
| InChIKey | FYOGILXNSLGFMP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|