C23H42O3Si — CID 134887512
[(2R,3S,4R,5R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl]oxy-triethylsilane (PubChem CID 134887512) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl]oxy-triethylsilane.
| Compound Name | [(2R,3S,4R,5R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134887512 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(2R,3S,4R,5R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-4-methoxy-5-methyloxan-3-yl]oxy-triethylsilane |
| SMILES | CCC/C=C/C=C/C=C(\C)[C@H]1OC[C@@H](C)[C@@H](OC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H42O3Si/c1-8-12-13-14-15-16-17-19(5)22-23(21(24-7)20(6)18-25-22)26-27(9-2,10-3)11-4/h13-17,20-23H,8-12,18H2,1-7H3/b14-13+,16-15+,19-17+/t20-,21-,22-,23+/m1/s1 |
| InChIKey | JPRYKFMJXFGXCU-GCECEZHOSA-N |
| XLogP | 6.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|