C29H54O4Si2 — CID 134957306
tert-butyl-[(2S,4E)-1-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-trimethylsilyloxypent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]-5-methylhepta-4,6-dien-2-yl]oxy-dimethylsilane (PubChem CID 134957306) has the molecular formula C29H54O4Si2 and a molecular weight of 522.92 g/mol. Its IUPAC name is tert-butyl-[(2S,4E)-1-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-trimethylsilyloxypent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]-5-methylhepta-4,6-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,4E)-1-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-trimethylsilyloxypent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]-5-methylhepta-4,6-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134957306 |
| Molecular Formula | C29H54O4Si2 |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | tert-butyl-[(2S,4E)-1-[(2S,6R)-2-[(2S,3R)-2-methoxy-3-methyl-4-trimethylsilyloxypent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]-5-methylhepta-4,6-dien-2-yl]oxy-dimethylsilane |
| SMILES | C=C/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](C[C@H](OC)[C@@H](C)C(=C)O[Si](C)(C)C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O4Si2/c1-14-22(2)18-19-27(33-35(12,13)29(5,6)7)20-25-16-15-17-26(31-25)21-28(30-8)23(3)24(4)32-34(9,10)11/h14-16,18,23,25-28H,1,4,17,19-21H2,2-3,5-13H3/b22-18+/t23-,25-,26-,27-,28-/m0/s1 |
| InChIKey | OJGKHCIQOOBHRS-ZAPYDZDPSA-N |
| XLogP | 8.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|