C18H32O2Si — CID 101185879
tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl]oxysilane (PubChem CID 101185879) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 101185879 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-2,6-bis[(E)-prop-1-enyl]oxan-3-yl]oxysilane |
| SMILES | C=C1C[C@H](/C=C/C)O[C@H](/C=C/C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O2Si/c1-9-11-15-13-14(3)17(16(19-15)12-10-2)20-21(7,8)18(4,5)6/h9-12,15-17H,3,13H2,1-2,4-8H3/b11-9+,12-10+/t15-,16+,17-/m0/s1 |
| InChIKey | SJNFMJBRKKRADR-HZDGNHARSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|