C19H34O4Si — CID 56605813
5-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]hexa-2,4-dienal (PubChem CID 56605813) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is 5-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]hexa-2,4-dienal.
| Compound Name | 5-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]hexa-2,4-dienal |
|---|---|
| PubChem CID | 56605813 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]hexa-2,4-dienal |
| SMILES | CO[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(C)=CC=CC=O)OC[C@H]1C |
| InChI | InChI=1S/C19H34O4Si/c1-14(11-9-10-12-20)17-18(16(21-6)15(2)13-22-17)23-24(7,8)19(3,4)5/h9-12,15-18H,13H2,1-8H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | UIHASFNPQHQINV-TVFCKZIOSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|