C22H36O5Si — CID 162397871
(2E,4E)-6-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-[(Z)-2-methyl-3-oxoprop-1-enyl]oxan-2-yl]hexa-2,4-dienoic acid (PubChem CID 162397871) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (2E,4E)-6-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-[(Z)-2-methyl-3-oxoprop-1-enyl]oxan-2-yl]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-[(Z)-2-methyl-3-oxoprop-1-enyl]oxan-2-yl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 162397871 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (2E,4E)-6-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-[(Z)-2-methyl-3-oxoprop-1-enyl]oxan-2-yl]hexa-2,4-dienoic acid |
| SMILES | C/C(C=O)=C/[C@H]1O[C@@H](C/C=C/C=C/C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C22H36O5Si/c1-16(15-23)13-19-17(2)20(27-28(6,7)22(3,4)5)14-18(26-19)11-9-8-10-12-21(24)25/h8-10,12-13,15,17-20H,11,14H2,1-7H3,(H,24,25)/b9-8+,12-10+,16-13-/t17-,18-,19+,20-/m0/s1 |
| InChIKey | SVNBQYMLYXGCBD-BVJVFZKSSA-N |
| XLogP | 4.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|