C16H30O3Si — CID 22848920
(E)-3-[(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxan-2-yl]but-2-enal (PubChem CID 22848920) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (E)-3-[(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxan-2-yl]but-2-enal.
| Compound Name | (E)-3-[(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxan-2-yl]but-2-enal |
|---|---|
| PubChem CID | 22848920 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (E)-3-[(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyloxan-2-yl]but-2-enal |
| SMILES | C/C(=C\C=O)[C@@H]1OC[C@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-12-10-14(19-20(6,7)16(3,4)5)15(18-11-12)13(2)8-9-17/h8-9,12,14-15H,10-11H2,1-7H3/b13-8+/t12-,14-,15+/m1/s1 |
| InChIKey | OBUFIGXAZPIVIS-NEOKKHMSSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|