C14H26O3Si — CID 11265714
(Z)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]prop-2-enal (PubChem CID 11265714) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is (Z)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]prop-2-enal.
| Compound Name | (Z)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 11265714 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (Z)-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]prop-2-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1/C=C\C=O |
| InChI | InChI=1S/C14H26O3Si/c1-14(2,3)18(4,5)17-13-9-7-11-16-12(13)8-6-10-15/h6,8,10,12-13H,7,9,11H2,1-5H3/b8-6-/t12-,13+/m1/s1 |
| InChIKey | OUUKFOZYNDGVRJ-UWNIJABGSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|