C28H50O5Si — CID 135047713
methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]oxan-2-yl]-4-methylocta-2,4-dienoate (PubChem CID 135047713) has the molecular formula C28H50O5Si and a molecular weight of 494.79 g/mol. Its IUPAC name is methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]oxan-2-yl]-4-methylocta-2,4-dienoate.
| Compound Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]oxan-2-yl]-4-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 135047713 |
| Molecular Formula | C28H50O5Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | methyl (2E,4E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8-[(2S,6S)-6-[(2S,3S)-2-methoxy-3-methylpent-4-enyl]oxan-2-yl]-4-methylocta-2,4-dienoate |
| SMILES | C=C[C@H](C)[C@H](C[C@@H]1CCC[C@@H](C[C@H](C/C=C(C)/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C)O1)OC |
| InChI | InChI=1S/C28H50O5Si/c1-11-22(3)26(30-7)20-24-14-12-13-23(32-24)19-25(33-34(9,10)28(4,5)6)17-15-21(2)16-18-27(29)31-8/h11,15-16,18,22-26H,1,12-14,17,19-20H2,2-10H3/b18-16+,21-15+/t22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | NJRBIGZLXQXZKD-ZAKZIPJLSA-N |
| XLogP | 7.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|