C22H36O6Si — CID 15934810
ethyl (2E,4E)-5-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]penta-2,4-dienoate (PubChem CID 15934810) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 15934810 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | ethyl (2E,4E)-5-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/[C@H]1OCC/C(=C\C(=O)OCC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O6Si/c1-8-25-19(23)13-11-10-12-18-21(28-29(6,7)22(3,4)5)17(14-15-27-18)16-20(24)26-9-2/h10-13,16,18,21H,8-9,14-15H2,1-7H3/b12-10+,13-11+,17-16+/t18-,21+/m1/s1 |
| InChIKey | CYQYRSXYLYHUPG-PAURMVCLSA-N |
| XLogP | 4.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|