C34H43NO3Si — CID 68768815
ethyl (2Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]acetate (PubChem CID 68768815) has the molecular formula C34H43NO3Si and a molecular weight of 541.81 g/mol. Its IUPAC name is ethyl (2Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]acetate |
|---|---|
| PubChem CID | 68768815 |
| Molecular Formula | C34H43NO3Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | ethyl (2Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H43NO3Si/c1-7-37-32(36)25-27-26-35(24-23-31(27)38-39(5,6)33(2,3)4)34(28-17-11-8-12-18-28,29-19-13-9-14-20-29)30-21-15-10-16-22-30/h8-22,25,31H,7,23-24,26H2,1-6H3/b27-25- |
| InChIKey | IYDCHCKCBXGBLK-RFBIWTDZSA-N |
| XLogP | 7.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|