C41H55N3O4Si — CID 69025868
ethyl 3-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]ethyl]-3-oxopiperazin-1-yl]propanoate (PubChem CID 69025868) has the molecular formula C41H55N3O4Si and a molecular weight of 681.99 g/mol. Its IUPAC name is ethyl 3-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]ethyl]-3-oxopiperazin-1-yl]propanoate.
| Compound Name | ethyl 3-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]ethyl]-3-oxopiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 69025868 |
| Molecular Formula | C41H55N3O4Si |
| Molecular Weight | 681.99 g/mol |
| Exact Mass | 681.40 |
| IUPAC Name | ethyl 3-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-1-tritylpiperidin-3-ylidene]ethyl]-3-oxopiperazin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCN(CC=C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2O[Si](C)(C)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C41H55N3O4Si/c1-7-47-39(46)25-26-42-29-30-43(38(45)32-42)27-23-33-31-44(28-24-37(33)48-49(5,6)40(2,3)4)41(34-17-11-8-12-18-34,35-19-13-9-14-20-35)36-21-15-10-16-22-36/h8-23,37H,7,24-32H2,1-6H3 |
| InChIKey | ADJHNUZAOWINRS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.99 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|