C36H39N3O3S — CID 87661998
ethyl 3-[1-[(2Z)-2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]propanoate (PubChem CID 87661998) has the molecular formula C36H39N3O3S and a molecular weight of 593.79 g/mol. Its IUPAC name is ethyl 3-[1-[(2Z)-2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]propanoate.
| Compound Name | ethyl 3-[1-[(2Z)-2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 87661998 |
| Molecular Formula | C36H39N3O3S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | ethyl 3-[1-[(2Z)-2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1cnn(C/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2SC(C)=O)c1 |
| InChI | InChI=1S/C36H39N3O3S/c1-3-42-35(41)20-19-29-25-37-39(26-29)24-21-30-27-38(23-22-34(30)43-28(2)40)36(31-13-7-4-8-14-31,32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-18,21,25-26,34H,3,19-20,22-24,27H2,1-2H3/b30-21- |
| InChIKey | QXUYNIDCPASGHI-OFWBYEQRSA-N |
| XLogP | 6.65 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|