C35H37N3O3S — CID 91266641
ethyl 2-[1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate (PubChem CID 91266641) has the molecular formula C35H37N3O3S and a molecular weight of 579.77 g/mol. Its IUPAC name is ethyl 2-[1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate.
| Compound Name | ethyl 2-[1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 91266641 |
| Molecular Formula | C35H37N3O3S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | ethyl 2-[1-[2-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)ethyl]pyrazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cnn(CC=C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2SC(C)=O)c1 |
| InChI | InChI=1S/C35H37N3O3S/c1-3-41-34(40)23-28-24-36-38(25-28)22-19-29-26-37(21-20-33(29)42-27(2)39)35(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-19,24-25,33H,3,20-23,26H2,1-2H3 |
| InChIKey | MNRPSNYHYFKZHJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|