C40H40N4O4S — CID 23139056
ethyl 5-[(Z)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate (PubChem CID 23139056) has the molecular formula C40H40N4O4S and a molecular weight of 672.85 g/mol. Its IUPAC name is ethyl 5-[(Z)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-[(Z)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 23139056 |
| Molecular Formula | C40H40N4O4S |
| Molecular Weight | 672.85 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | ethyl 5-[(Z)-(4-acetylsulfanyl-1-tritylpiperidin-3-ylidene)methyl]-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(/C=C2/CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2SC(C)=O)nnn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C40H40N4O4S/c1-4-48-39(46)38-36(41-42-44(38)27-30-20-22-35(47-3)23-21-30)26-31-28-43(25-24-37(31)49-29(2)45)40(32-14-8-5-9-15-32,33-16-10-6-11-17-33)34-18-12-7-13-19-34/h5-23,26,37H,4,24-25,27-28H2,1-3H3/b31-26- |
| InChIKey | WYKRHFHRIMMBBC-ZXPTYKNPSA-N |
| XLogP | 7.24 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.85 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|