C38H36N4O4 — CID 68764548
ethyl 3-[(4-methoxyphenyl)methyl]-5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazole-4-carboxylate (PubChem CID 68764548) has the molecular formula C38H36N4O4 and a molecular weight of 612.73 g/mol. Its IUPAC name is ethyl 3-[(4-methoxyphenyl)methyl]-5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 3-[(4-methoxyphenyl)methyl]-5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 68764548 |
| Molecular Formula | C38H36N4O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | ethyl 3-[(4-methoxyphenyl)methyl]-5-[(E)-(4-oxo-1-tritylpiperidin-3-ylidene)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(/C=C2\CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CCC2=O)nnn1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H36N4O4/c1-3-46-37(44)36-34(39-40-42(36)26-28-19-21-33(45-2)22-20-28)25-29-27-41(24-23-35(29)43)38(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-22,25H,3,23-24,26-27H2,1-2H3/b29-25+ |
| InChIKey | LELTZQPAHNOVMU-XLVZBRSZSA-N |
| XLogP | 6.16 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|