C33H32N2O3 — CID 68765147
ethyl 2-[2-[(4-oxo-1-tritylpiperidin-3-ylidene)methyl]pyrrol-1-yl]acetate (PubChem CID 68765147) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is ethyl 2-[2-[(4-oxo-1-tritylpiperidin-3-ylidene)methyl]pyrrol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-oxo-1-tritylpiperidin-3-ylidene)methyl]pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 68765147 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | ethyl 2-[2-[(4-oxo-1-tritylpiperidin-3-ylidene)methyl]pyrrol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cccc1C=C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1=O |
| InChI | InChI=1S/C33H32N2O3/c1-2-38-32(37)25-34-21-12-19-30(34)23-26-24-35(22-20-31(26)36)33(27-13-6-3-7-14-27,28-15-8-4-9-16-28)29-17-10-5-11-18-29/h3-19,21,23H,2,20,22,24-25H2,1H3 |
| InChIKey | VGBWOAAXCZDBEF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|